C16H23Cl2N3O2 — CID 129252682
4-[5-[bis(2-chloroethyl)amino]-1-methyl-4,5-dihydrobenzimidazol-2-yl]butanoic acid (PubChem CID 129252682) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 4-[5-[bis(2-chloroethyl)amino]-1-methyl-4,5-dihydrobenzimidazol-2-yl]butanoic acid.
| Compound Name | 4-[5-[bis(2-chloroethyl)amino]-1-methyl-4,5-dihydrobenzimidazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 129252682 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-[5-[bis(2-chloroethyl)amino]-1-methyl-4,5-dihydrobenzimidazol-2-yl]butanoic acid |
| SMILES | Cn1c(CCCC(=O)O)nc2c1C=CC(N(CCCl)CCCl)C2 |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,12H,2-4,7-11H2,1H3,(H,22,23) |
| InChIKey | YHESQLRUHZNHRN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|