C20H23NO2S — CID 123503791
4-[1-(2-methoxypropan-2-yloxy)ethyl]-2-(2-methyl-1-benzothiophen-7-yl)pyridine (PubChem CID 123503791) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 4-[1-(2-methoxypropan-2-yloxy)ethyl]-2-(2-methyl-1-benzothiophen-7-yl)pyridine.
| Compound Name | 4-[1-(2-methoxypropan-2-yloxy)ethyl]-2-(2-methyl-1-benzothiophen-7-yl)pyridine |
|---|---|
| PubChem CID | 123503791 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[1-(2-methoxypropan-2-yloxy)ethyl]-2-(2-methyl-1-benzothiophen-7-yl)pyridine |
| SMILES | COC(C)(C)OC(C)c1ccnc(-c2cccc3cc(C)sc23)c1 |
| InChI | InChI=1S/C20H23NO2S/c1-13-11-16-7-6-8-17(19(16)24-13)18-12-15(9-10-21-18)14(2)23-20(3,4)22-5/h6-12,14H,1-5H3 |
| InChIKey | JTXTYUBAXFDFMF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|