C29H34O5 — CID 123504617
3-[3-[[4-(3,3-dimethylbutoxymethyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methylbenzoic acid (PubChem CID 123504617) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-[3-[[4-(3,3-dimethylbutoxymethyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methylbenzoic acid.
| Compound Name | 3-[3-[[4-(3,3-dimethylbutoxymethyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 123504617 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[3-[[4-(3,3-dimethylbutoxymethyl)-3-hydroxy-2-methylphenoxy]methyl]phenyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1cccc(COc2ccc(COCCC(C)(C)C)c(O)c2C)c1 |
| InChI | InChI=1S/C29H34O5/c1-19-9-10-23(28(31)32)16-25(19)22-8-6-7-21(15-22)17-34-26-12-11-24(27(30)20(26)2)18-33-14-13-29(3,4)5/h6-12,15-16,30H,13-14,17-18H2,1-5H3,(H,31,32) |
| InChIKey | ZLFQVTACYFHMFV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|