C13H19N — CID 123505686
5-buta-1,3-dienyl-6-ethyl-2,4-dimethyl-2,3-dihydropyridine (PubChem CID 123505686) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-buta-1,3-dienyl-6-ethyl-2,4-dimethyl-2,3-dihydropyridine.
| Compound Name | 5-buta-1,3-dienyl-6-ethyl-2,4-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123505686 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 5-buta-1,3-dienyl-6-ethyl-2,4-dimethyl-2,3-dihydropyridine |
| SMILES | C=CC=CC1=C(C)CC(C)N=C1CC |
| InChI | InChI=1S/C13H19N/c1-5-7-8-12-10(3)9-11(4)14-13(12)6-2/h5,7-8,11H,1,6,9H2,2-4H3 |
| InChIKey | LFMFKHLNLHZMAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|