C9H13F3N4 — CID 123505695
3-methyl-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]pent-4-en-1-amine (PubChem CID 123505695) has the molecular formula C9H13F3N4 and a molecular weight of 234.22 g/mol. Its IUPAC name is 3-methyl-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]pent-4-en-1-amine.
| Compound Name | 3-methyl-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 123505695 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 3-methyl-1-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]pent-4-en-1-amine |
| SMILES | C=CC(C)CC(N)c1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C9H13F3N4/c1-3-5(2)4-6(13)7-14-8(16-15-7)9(10,11)12/h3,5-6H,1,4,13H2,2H3,(H,14,15,16) |
| InChIKey | FCFCUCCXODUNGY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|