C11H20N4O2 — CID 123506612
1,3-dimorpholin-4-ylpropane-1,3-diimine (PubChem CID 123506612) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,3-dimorpholin-4-ylpropane-1,3-diimine.
| Compound Name | 1,3-dimorpholin-4-ylpropane-1,3-diimine |
|---|---|
| PubChem CID | 123506612 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1,3-dimorpholin-4-ylpropane-1,3-diimine |
| SMILES | [H]/N=C(/C/C(=N/[H])N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C11H20N4O2/c12-10(14-1-5-16-6-2-14)9-11(13)15-3-7-17-8-4-15/h12-13H,1-9H2/b12-10-,13-11- |
| InChIKey | SLDWDTUGLINZCF-MIMPSMLTSA-N |
| XLogP | -0.00 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|