C9H16F2N2O2 — CID 103150910
3-(2,2-difluoroethoxy)-1-morpholin-4-ylpropan-1-imine (PubChem CID 103150910) has the molecular formula C9H16F2N2O2 and a molecular weight of 222.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-morpholin-4-ylpropan-1-imine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-morpholin-4-ylpropan-1-imine |
|---|---|
| PubChem CID | 103150910 |
| Molecular Formula | C9H16F2N2O2 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-morpholin-4-ylpropan-1-imine |
| SMILES | [H]/N=C(\CCOCC(F)F)N1CCOCC1 |
| InChI | InChI=1S/C9H16F2N2O2/c10-8(11)7-15-4-1-9(12)13-2-5-14-6-3-13/h8,12H,1-7H2/b12-9+ |
| InChIKey | HBIAEUKEXBAHHZ-FMIVXFBMSA-N |
| XLogP | 0.97 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|