C9H18N2 — CID 123508191
N'-(2-methylcyclohex-3-en-1-yl)ethane-1,2-diamine (PubChem CID 123508191) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N'-(2-methylcyclohex-3-en-1-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-methylcyclohex-3-en-1-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123508191 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N'-(2-methylcyclohex-3-en-1-yl)ethane-1,2-diamine |
| SMILES | CC1C=CCCC1NCCN |
| InChI | InChI=1S/C9H18N2/c1-8-4-2-3-5-9(8)11-7-6-10/h2,4,8-9,11H,3,5-7,10H2,1H3 |
| InChIKey | ZQTCRECIVSRVPH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|