C11H18FN — CID 138655203
3-fluoro-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridine (PubChem CID 138655203) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is 3-fluoro-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-fluoro-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 138655203 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-fluoro-4-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,3,6-tetrahydropyridine |
| SMILES | C/C=C\C1NCC=C(C(C)C)C1F |
| InChI | InChI=1S/C11H18FN/c1-4-5-10-11(12)9(8(2)3)6-7-13-10/h4-6,8,10-11,13H,7H2,1-3H3/b5-4- |
| InChIKey | YQIFUQHXRFGKSJ-PLNGDYQASA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|