C8H9N5 — CID 123508834
4-iminoquinazoline-3,7-diamine (PubChem CID 123508834) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-iminoquinazoline-3,7-diamine.
| Compound Name | 4-iminoquinazoline-3,7-diamine |
|---|---|
| PubChem CID | 123508834 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 4-iminoquinazoline-3,7-diamine |
| SMILES | [H]/N=c1\c2ccc(N)cc2ncn1N |
| InChI | InChI=1S/C8H9N5/c9-5-1-2-6-7(3-5)12-4-13(11)8(6)10/h1-4,10H,9,11H2/b10-8+ |
| InChIKey | FOGXIFGCRMSDCB-CSKARUKUSA-N |
| XLogP | -0.19 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|