C8H8N4O — CID 123508601
3,7-diaminoquinazolin-4-one (PubChem CID 123508601) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 3,7-diaminoquinazolin-4-one.
| Compound Name | 3,7-diaminoquinazolin-4-one |
|---|---|
| PubChem CID | 123508601 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3,7-diaminoquinazolin-4-one |
| SMILES | Nc1ccc2c(=O)n(N)cnc2c1 |
| InChI | InChI=1S/C8H8N4O/c9-5-1-2-6-7(3-5)11-4-12(10)8(6)13/h1-4H,9-10H2 |
| InChIKey | SKTBICSVYXVYNM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|