C10H9N3O3 — CID 121215575
3-amino-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-one (PubChem CID 121215575) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 3-amino-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-one.
| Compound Name | 3-amino-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-one |
|---|---|
| PubChem CID | 121215575 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 3-amino-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-one |
| SMILES | Nn1cnc2cc3c(cc2c1=O)OCCO3 |
| InChI | InChI=1S/C10H9N3O3/c11-13-5-12-7-4-9-8(15-1-2-16-9)3-6(7)10(13)14/h3-5H,1-2,11H2 |
| InChIKey | XKGHMGLISNGEJV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |