C18H19N5OS2 — CID 1235089
5-[[4-(dimethylamino)phenyl]methylidene]-3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1235089) has the molecular formula C18H19N5OS2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylidene]-3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylidene]-3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1235089 |
| Molecular Formula | C18H19N5OS2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylidene]-3-[(4,6-dimethylpyrimidin-2-yl)amino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)nc(NN2C(=O)C(=Cc3ccc(N(C)C)cc3)SC2=S)n1 |
| InChI | InChI=1S/C18H19N5OS2/c1-11-9-12(2)20-17(19-11)21-23-16(24)15(26-18(23)25)10-13-5-7-14(8-6-13)22(3)4/h5-10H,1-4H3,(H,19,20,21) |
| InChIKey | RHKQJQFNACORCP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|