C17H16N4O2S2 — CID 2251640
(5Z)-3-[(4,6-dimethylpyrimidin-2-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2251640) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is (5Z)-3-[(4,6-dimethylpyrimidin-2-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(4,6-dimethylpyrimidin-2-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2251640 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5Z)-3-[(4,6-dimethylpyrimidin-2-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=C1\SC(=S)N(Nc2nc(C)cc(C)n2)C1=O |
| InChI | InChI=1S/C17H16N4O2S2/c1-10-8-11(2)19-16(18-10)20-21-15(22)14(25-17(21)24)9-12-6-4-5-7-13(12)23-3/h4-9H,1-3H3,(H,18,19,20)/b14-9- |
| InChIKey | YWDAARKZWPIJRZ-ZROIWOOFSA-N |
| XLogP | 3.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|