C26H24N6O4S2 — CID 98360913
8-[[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-1,3-dimethyl-7-(2-phenylethyl)purine-2,6-dione (PubChem CID 98360913) has the molecular formula C26H24N6O4S2 and a molecular weight of 548.65 g/mol. Its IUPAC name is 8-[[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-1,3-dimethyl-7-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 8-[[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-1,3-dimethyl-7-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 98360913 |
| Molecular Formula | C26H24N6O4S2 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 8-[[(5E)-5-[(2-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]-1,3-dimethyl-7-(2-phenylethyl)purine-2,6-dione |
| SMILES | COc1ccccc1/C=C1/SC(=S)N(Nc2nc3c(c(=O)n(C)c(=O)n3C)n2CCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H24N6O4S2/c1-29-21-20(23(34)30(2)25(29)35)31(14-13-16-9-5-4-6-10-16)24(27-21)28-32-22(33)19(38-26(32)37)15-17-11-7-8-12-18(17)36-3/h4-12,15H,13-14H2,1-3H3,(H,27,28)/b19-15+ |
| InChIKey | SETUYXOHJZVLKX-XDJHFCHBSA-N |
| XLogP | 2.91 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|