C21H18N2O6S2 — CID 18880261
(5Z)-3-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18880261) has the molecular formula C21H18N2O6S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (5Z)-3-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18880261 |
| Molecular Formula | C21H18N2O6S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | (5Z)-3-[(4,5-dimethoxy-3-oxo-1H-2-benzofuran-1-yl)amino]-5-[(2-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=C1\SC(=S)N(NC2OC(=O)c3c2ccc(OC)c3OC)C1=O |
| InChI | InChI=1S/C21H18N2O6S2/c1-26-13-7-5-4-6-11(13)10-15-19(24)23(21(30)31-15)22-18-12-8-9-14(27-2)17(28-3)16(12)20(25)29-18/h4-10,18,22H,1-3H3/b15-10- |
| InChIKey | ADSSETRKWAWYOL-GDNBJRDFSA-N |
| XLogP | 3.29 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|