C20H18N2O4S2 — CID 1420026
N-[5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 1420026) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | N-[5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 1420026 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | COc1cccc(C=C2SC(=S)N(NC(=O)c3ccc(C)cc3)C2=O)c1OC |
| InChI | InChI=1S/C20H18N2O4S2/c1-12-7-9-13(10-8-12)18(23)21-22-19(24)16(28-20(22)27)11-14-5-4-6-15(25-2)17(14)26-3/h4-11H,1-3H3,(H,21,23) |
| InChIKey | VMBSXQIFMSBINB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|