C20H15ClN2O6S2 — CID 27410955
6-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 27410955) has the molecular formula C20H15ClN2O6S2 and a molecular weight of 478.94 g/mol. Its IUPAC name is 6-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 27410955 |
| Molecular Formula | C20H15ClN2O6S2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 6-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(/C=C2/SC(=S)N(NC(=O)c3cccc(Cl)c3)C2=O)c(C(=O)O)c1OC |
| InChI | InChI=1S/C20H15ClN2O6S2/c1-28-13-7-6-10(15(19(26)27)16(13)29-2)9-14-18(25)23(20(30)31-14)22-17(24)11-4-3-5-12(21)8-11/h3-9H,1-2H3,(H,22,24)(H,26,27)/b14-9+ |
| InChIKey | OLWKOQVVVVJGNF-NTEUORMPSA-N |
| XLogP | 3.60 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|