C18H11ClN2O4S2 — CID 19200304
2-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 19200304) has the molecular formula C18H11ClN2O4S2 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 19200304 |
| Molecular Formula | C18H11ClN2O4S2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 2-[(E)-[3-[(3-chlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(NN1C(=O)/C(=C\c2ccccc2C(=O)O)SC1=S)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H11ClN2O4S2/c19-12-6-3-5-11(8-12)15(22)20-21-16(23)14(27-18(21)26)9-10-4-1-2-7-13(10)17(24)25/h1-9H,(H,20,22)(H,24,25)/b14-9+ |
| InChIKey | GRSQXQDEVFCJTD-NTEUORMPSA-N |
| XLogP | 3.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|