C16H10ClN3O2S2 — CID 3799466
3-chloro-N-[4-oxo-5-(pyridin-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 3799466) has the molecular formula C16H10ClN3O2S2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-chloro-N-[4-oxo-5-(pyridin-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-chloro-N-[4-oxo-5-(pyridin-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 3799466 |
| Molecular Formula | C16H10ClN3O2S2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 3-chloro-N-[4-oxo-5-(pyridin-3-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)C(=Cc2cccnc2)SC1=S)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10ClN3O2S2/c17-12-5-1-4-11(8-12)14(21)19-20-15(22)13(24-16(20)23)7-10-3-2-6-18-9-10/h1-9H,(H,19,21) |
| InChIKey | BURZMDMCTWOWTR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|