C28H32ClN5O2 — CID 123509521
1-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-3-methyl-3-(2,2,3-trimethylbutyl)aziridin-2-one (PubChem CID 123509521) has the molecular formula C28H32ClN5O2 and a molecular weight of 506.05 g/mol. Its IUPAC name is 1-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-3-methyl-3-(2,2,3-trimethylbutyl)aziridin-2-one.
| Compound Name | 1-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-3-methyl-3-(2,2,3-trimethylbutyl)aziridin-2-one |
|---|---|
| PubChem CID | 123509521 |
| Molecular Formula | C28H32ClN5O2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 1-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]-3-methyl-3-(2,2,3-trimethylbutyl)aziridin-2-one |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(N1C(=O)C1(C)CC(C)(C)C(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C28H32ClN5O2/c1-16(2)27(4,5)15-28(6)26(35)34(28)24-25-32-31-17(3)33(25)22-13-12-20(36-7)14-21(22)23(30-24)18-8-10-19(29)11-9-18/h8-14,16,24H,15H2,1-7H3 |
| InChIKey | KXDVZURAWCJNSN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|