C11H19N3 — CID 123509905
1-methanidyl-2-(2-pyrazol-1-ylethyl)piperidin-1-ium (PubChem CID 123509905) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-methanidyl-2-(2-pyrazol-1-ylethyl)piperidin-1-ium.
| Compound Name | 1-methanidyl-2-(2-pyrazol-1-ylethyl)piperidin-1-ium |
|---|---|
| PubChem CID | 123509905 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-methanidyl-2-(2-pyrazol-1-ylethyl)piperidin-1-ium |
| SMILES | [CH2-][NH+]1CCCCC1CCn1cccn1 |
| InChI | InChI=1S/C11H19N3/c1-13-8-3-2-5-11(13)6-10-14-9-4-7-12-14/h4,7,9,11,13H,1-3,5-6,8,10H2 |
| InChIKey | SBNQINHHPFUJSY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 22.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|