C14H19NO2 — CID 123510289
(2S)-2-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide (PubChem CID 123510289) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2S)-2-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide.
| Compound Name | (2S)-2-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
|---|---|
| PubChem CID | 123510289 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2S)-2-(5-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)propanamide |
| SMILES | COc1cccc2c1CCC([C@H](C)C(N)=O)C2 |
| InChI | InChI=1S/C14H19NO2/c1-9(14(15)16)10-6-7-12-11(8-10)4-3-5-13(12)17-2/h3-5,9-10H,6-8H2,1-2H3,(H2,15,16)/t9-,10?/m0/s1 |
| InChIKey | YIZKBDUASLZFDP-RGURZIINSA-N |
| XLogP | 1.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |