C22H26FNO2S2 — CID 123510336
5-[bis(methylsulfanyl)methylidene]-2-ethyl-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 123510336) has the molecular formula C22H26FNO2S2 and a molecular weight of 419.59 g/mol. Its IUPAC name is 5-[bis(methylsulfanyl)methylidene]-2-ethyl-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | 5-[bis(methylsulfanyl)methylidene]-2-ethyl-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 123510336 |
| Molecular Formula | C22H26FNO2S2 |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-[bis(methylsulfanyl)methylidene]-2-ethyl-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | CCC12C3CCC(C3)C1C(=O)C(=C(SC)SC)C(=O)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FNO2S2/c1-4-22-15-8-7-14(11-15)18(22)19(25)17(21(27-2)28-3)20(26)24(22)12-13-5-9-16(23)10-6-13/h5-6,9-10,14-15,18H,4,7-8,11-12H2,1-3H3 |
| InChIKey | XKSJGIDBTDIAKP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|