C20H22FNO2S2 — CID 143912315
(1R,2S,7R)-5-[bis(methylsulfanyl)methylidene]-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione (PubChem CID 143912315) has the molecular formula C20H22FNO2S2 and a molecular weight of 391.53 g/mol. Its IUPAC name is (1R,2S,7R)-5-[bis(methylsulfanyl)methylidene]-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione.
| Compound Name | (1R,2S,7R)-5-[bis(methylsulfanyl)methylidene]-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
|---|---|
| PubChem CID | 143912315 |
| Molecular Formula | C20H22FNO2S2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (1R,2S,7R)-5-[bis(methylsulfanyl)methylidene]-3-[(4-fluorophenyl)methyl]-3-azatricyclo[6.2.1.02,7]undecane-4,6-dione |
| SMILES | CSC(SC)=C1C(=O)[C@@H]2C3CC[C@H](C3)[C@@H]2N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H22FNO2S2/c1-25-20(26-2)16-18(23)15-12-5-6-13(9-12)17(15)22(19(16)24)10-11-3-7-14(21)8-4-11/h3-4,7-8,12-13,15,17H,5-6,9-10H2,1-2H3/t12?,13-,15-,17+/m1/s1 |
| InChIKey | QTCFDBPAWFDBQK-XTKWBPSRSA-N |
| XLogP | 4.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|