C19H24N6O2S — CID 123512286
N-[4-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]sulfinylphenyl]prop-2-enamide (PubChem CID 123512286) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is N-[4-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]sulfinylphenyl]prop-2-enamide.
| Compound Name | N-[4-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]sulfinylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123512286 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[4-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]sulfinylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S(=O)N2CCN(c3ccnc(N(C)C)n3)CC2)cc1 |
| InChI | InChI=1S/C19H24N6O2S/c1-4-18(26)21-15-5-7-16(8-6-15)28(27)25-13-11-24(12-14-25)17-9-10-20-19(22-17)23(2)3/h4-10H,1,11-14H2,2-3H3,(H,21,26) |
| InChIKey | RDAORUCWYJZGTD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|