C22H22N4O2S — CID 123710050
N-[4-(4-isoquinolin-1-ylpiperazin-1-yl)sulfinylphenyl]prop-2-enamide (PubChem CID 123710050) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[4-(4-isoquinolin-1-ylpiperazin-1-yl)sulfinylphenyl]prop-2-enamide.
| Compound Name | N-[4-(4-isoquinolin-1-ylpiperazin-1-yl)sulfinylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123710050 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[4-(4-isoquinolin-1-ylpiperazin-1-yl)sulfinylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S(=O)N2CCN(c3nccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-2-21(27)24-18-7-9-19(10-8-18)29(28)26-15-13-25(14-16-26)22-20-6-4-3-5-17(20)11-12-23-22/h2-12H,1,13-16H2,(H,24,27) |
| InChIKey | LUHDSLZOMVGGLO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|