C18H22N4O2 — CID 121415420
[3-(4-isoquinolin-1-ylpiperazin-1-yl)cyclobutyl]carbamic acid (PubChem CID 121415420) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is [3-(4-isoquinolin-1-ylpiperazin-1-yl)cyclobutyl]carbamic acid.
| Compound Name | [3-(4-isoquinolin-1-ylpiperazin-1-yl)cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 121415420 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3-(4-isoquinolin-1-ylpiperazin-1-yl)cyclobutyl]carbamic acid |
| SMILES | O=C(O)NC1CC(N2CCN(c3nccc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(24)20-14-11-15(12-14)21-7-9-22(10-8-21)17-16-4-2-1-3-13(16)5-6-19-17/h1-6,14-15,20H,7-12H2,(H,23,24) |
| InChIKey | IIUZBKQENYUNNB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |