C10H13N2+ — CID 123513583
3-(3,4-dihydropyridin-1-ium-1-yl)-2,3-dihydropyridine (PubChem CID 123513583) has the molecular formula C10H13N2+ and a molecular weight of 161.23 g/mol. Its IUPAC name is 3-(3,4-dihydropyridin-1-ium-1-yl)-2,3-dihydropyridine.
| Compound Name | 3-(3,4-dihydropyridin-1-ium-1-yl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 123513583 |
| Molecular Formula | C10H13N2+ |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 3-(3,4-dihydropyridin-1-ium-1-yl)-2,3-dihydropyridine |
| SMILES | C1=CC([N+]2=CCCC=C2)CN=C1 |
| InChI | InChI=1S/C10H13N2/c1-2-7-12(8-3-1)10-5-4-6-11-9-10/h2,4-8,10H,1,3,9H2/q+1 |
| InChIKey | GRIWOHFKSIERLP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|