C8H11N — CID 123514110
N-methylhepta-1,4,6-trien-3-imine (PubChem CID 123514110) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is N-methylhepta-1,4,6-trien-3-imine.
| Compound Name | N-methylhepta-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 123514110 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | N-methylhepta-1,4,6-trien-3-imine |
| SMILES | C=CC=C/C(C=C)=N/C |
| InChI | InChI=1S/C8H11N/c1-4-6-7-8(5-2)9-3/h4-7H,1-2H2,3H3/b7-6?,9-8+ |
| InChIKey | OGFMNBPUGUWLSF-ANYPYVPJSA-N |
| XLogP | 1.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|