C14H24 — CID 123514409
1-(3,4-dimethylhex-1-yn-3-yl)-1,2,3-trimethylcyclopropane (PubChem CID 123514409) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1-(3,4-dimethylhex-1-yn-3-yl)-1,2,3-trimethylcyclopropane.
| Compound Name | 1-(3,4-dimethylhex-1-yn-3-yl)-1,2,3-trimethylcyclopropane |
|---|---|
| PubChem CID | 123514409 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1-(3,4-dimethylhex-1-yn-3-yl)-1,2,3-trimethylcyclopropane |
| SMILES | C#CC(C)(C(C)CC)C1(C)C(C)C1C |
| InChI | InChI=1S/C14H24/c1-8-10(3)13(6,9-2)14(7)11(4)12(14)5/h2,10-12H,8H2,1,3-7H3 |
| InChIKey | WYYQEXKRNXBKDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|