C31H41N5O4 — CID 123515320
N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl)-3-pyridinyl]-5-[(methylideneamino)methyl]-1H-imidazole-2-carboxamide (PubChem CID 123515320) has the molecular formula C31H41N5O4 and a molecular weight of 547.70 g/mol. Its IUPAC name is N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl)-3-pyridinyl]-5-[(methylideneamino)methyl]-1H-imidazole-2-carboxamide.
| Compound Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl)-3-pyridinyl]-5-[(methylideneamino)methyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 123515320 |
| Molecular Formula | C31H41N5O4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(1,4,4,7-tetramethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-9-yl)-3-pyridinyl]-5-[(methylideneamino)methyl]-1H-imidazole-2-carboxamide |
| SMILES | C=NCc1cnc(C(=O)Nc2ccc(C3CC4(C)OC(C)(C3)C3OC(C)(C)OC34)nc2C2=CCC(C)(C)CC2)[nH]1 |
| InChI | InChI=1S/C31H41N5O4/c1-28(2)12-10-18(11-13-28)23-22(36-27(37)26-33-17-20(34-26)16-32-7)9-8-21(35-23)19-14-30(5)24-25(31(6,15-19)40-30)39-29(3,4)38-24/h8-10,17,19,24-25H,7,11-16H2,1-6H3,(H,33,34)(H,36,37) |
| InChIKey | CIBVXJIFSUACKS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|