C19H22F3N7O2 — CID 123515688
2-[[3-[5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-triazin-5-yl]amino]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 123515688) has the molecular formula C19H22F3N7O2 and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-[[3-[5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-triazin-5-yl]amino]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-[[3-[5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-triazin-5-yl]amino]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 123515688 |
| Molecular Formula | C19H22F3N7O2 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[[3-[5-(methoxymethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-1,2,4-triazin-5-yl]amino]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | COCc1cnc2[nH]cc(-c3nncc(NC(C(=O)NCC(F)(F)F)C(C)C)n3)c2c1 |
| InChI | InChI=1S/C19H22F3N7O2/c1-10(2)15(18(30)25-9-19(20,21)22)27-14-7-26-29-17(28-14)13-6-24-16-12(13)4-11(5-23-16)8-31-3/h4-7,10,15H,8-9H2,1-3H3,(H,23,24)(H,25,30)(H,27,28,29) |
| InChIKey | ORNFKLXMCORYLU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |