C15H25N — CID 123515738
N-ethyl-6,6-dimethylundeca-3,7,10-trien-1-imine (PubChem CID 123515738) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-ethyl-6,6-dimethylundeca-3,7,10-trien-1-imine.
| Compound Name | N-ethyl-6,6-dimethylundeca-3,7,10-trien-1-imine |
|---|---|
| PubChem CID | 123515738 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-ethyl-6,6-dimethylundeca-3,7,10-trien-1-imine |
| SMILES | C=CCC=CC(C)(C)CC=CC/C=N/CC |
| InChI | InChI=1S/C15H25N/c1-5-7-9-12-15(3,4)13-10-8-11-14-16-6-2/h5,8-10,12,14H,1,6-7,11,13H2,2-4H3/b10-8?,12-9?,16-14+ |
| InChIKey | NCZLHVWESRASPM-KYUWWUPWSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|