C29H25ClFN3O3 — CID 123517639
1-[2-[4-(4-chlorophenyl)-6-fluoro-7-hydroxy-3,3-dimethyl-2H-indol-1-yl]phenyl]-3-(4-hydroxyphenyl)urea (PubChem CID 123517639) has the molecular formula C29H25ClFN3O3 and a molecular weight of 517.99 g/mol. Its IUPAC name is 1-[2-[4-(4-chlorophenyl)-6-fluoro-7-hydroxy-3,3-dimethyl-2H-indol-1-yl]phenyl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[2-[4-(4-chlorophenyl)-6-fluoro-7-hydroxy-3,3-dimethyl-2H-indol-1-yl]phenyl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 123517639 |
| Molecular Formula | C29H25ClFN3O3 |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 1-[2-[4-(4-chlorophenyl)-6-fluoro-7-hydroxy-3,3-dimethyl-2H-indol-1-yl]phenyl]-3-(4-hydroxyphenyl)urea |
| SMILES | CC1(C)CN(c2ccccc2NC(=O)Nc2ccc(O)cc2)c2c(O)c(F)cc(-c3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C29H25ClFN3O3/c1-29(2)16-34(26-25(29)21(15-22(31)27(26)36)17-7-9-18(30)10-8-17)24-6-4-3-5-23(24)33-28(37)32-19-11-13-20(35)14-12-19/h3-15,35-36H,16H2,1-2H3,(H2,32,33,37) |
| InChIKey | PPLDVBDXLOTZFD-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|