C5H9F2NO — CID 123518217
(2,2-difluoropyrrolidin-3-yl)methanol (PubChem CID 123518217) has the molecular formula C5H9F2NO and a molecular weight of 137.13 g/mol. Its IUPAC name is (2,2-difluoropyrrolidin-3-yl)methanol.
| Compound Name | (2,2-difluoropyrrolidin-3-yl)methanol |
|---|---|
| PubChem CID | 123518217 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | (2,2-difluoropyrrolidin-3-yl)methanol |
| SMILES | OCC1CCNC1(F)F |
| InChI | InChI=1S/C5H9F2NO/c6-5(7)4(3-9)1-2-8-5/h4,8-9H,1-3H2 |
| InChIKey | QADSBLVDSHXGAF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|