C11H17NO2 — CID 123519400
ethyl 6-propyl-2,3-dihydropyridine-5-carboxylate (PubChem CID 123519400) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is ethyl 6-propyl-2,3-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 6-propyl-2,3-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 123519400 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | ethyl 6-propyl-2,3-dihydropyridine-5-carboxylate |
| SMILES | CCCC1=NCCC=C1C(=O)OCC |
| InChI | InChI=1S/C11H17NO2/c1-3-6-10-9(7-5-8-12-10)11(13)14-4-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | QHCKXVDTMHBOHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |