C19H29NO2 — CID 90769281
ethyl 4-(2-methyl-7-methyliminooct-3-en-4-yl)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 90769281) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is ethyl 4-(2-methyl-7-methyliminooct-3-en-4-yl)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 4-(2-methyl-7-methyliminooct-3-en-4-yl)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 90769281 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 4-(2-methyl-7-methyliminooct-3-en-4-yl)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC=C(C(=CC(C)C)CC/C(C)=N/C)CC1 |
| InChI | InChI=1S/C19H29NO2/c1-6-22-19(21)17-11-9-16(10-12-17)18(13-14(2)3)8-7-15(4)20-5/h9,11,13-14H,6-8,10,12H2,1-5H3/b18-13?,20-15+ |
| InChIKey | UMTUIALJQAKUFC-OHGDFSGPSA-N |
| XLogP | 4.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|