C15H21NO2 — CID 123433506
methyl (2Z)-3-ethenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)hepta-2,5-dienoate (PubChem CID 123433506) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl (2Z)-3-ethenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)hepta-2,5-dienoate.
| Compound Name | methyl (2Z)-3-ethenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)hepta-2,5-dienoate |
|---|---|
| PubChem CID | 123433506 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl (2Z)-3-ethenyl-2-(2,3,4,5-tetrahydropyridin-6-yl)hepta-2,5-dienoate |
| SMILES | C=C/C(CC=CC)=C(\C(=O)OC)C1=NCCCC1 |
| InChI | InChI=1S/C15H21NO2/c1-4-6-9-12(5-2)14(15(17)18-3)13-10-7-8-11-16-13/h4-6H,2,7-11H2,1,3H3/b6-4?,14-12+ |
| InChIKey | DRCTYDYFILAPDG-CALOEKBMSA-N |
| XLogP | 3.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|