C11H17NO2 — CID 140603194
methyl (E)-2-[(2S)-5-ethyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate (PubChem CID 140603194) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl (E)-2-[(2S)-5-ethyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate.
| Compound Name | methyl (E)-2-[(2S)-5-ethyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 140603194 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl (E)-2-[(2S)-5-ethyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate |
| SMILES | C/C=C(/C(=O)OC)[C@@H]1CCC(CC)=N1 |
| InChI | InChI=1S/C11H17NO2/c1-4-8-6-7-10(12-8)9(5-2)11(13)14-3/h5,10H,4,6-7H2,1-3H3/b9-5+/t10-/m0/s1 |
| InChIKey | AAUKLSIIIORANA-CYNRKNSPSA-N |
| XLogP | 2.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|