C12H19NO2 — CID 140603197
methyl (Z)-2-[(2S)-5-propyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate (PubChem CID 140603197) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl (Z)-2-[(2S)-5-propyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate.
| Compound Name | methyl (Z)-2-[(2S)-5-propyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 140603197 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl (Z)-2-[(2S)-5-propyl-3,4-dihydro-2H-pyrrol-2-yl]but-2-enoate |
| SMILES | C/C=C(\C(=O)OC)[C@@H]1CCC(CCC)=N1 |
| InChI | InChI=1S/C12H19NO2/c1-4-6-9-7-8-11(13-9)10(5-2)12(14)15-3/h5,11H,4,6-8H2,1-3H3/b10-5-/t11-/m0/s1 |
| InChIKey | ISSUZMRKQWNPKY-VQNWOSHQSA-N |
| XLogP | 2.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|