C18H29NO3 — CID 135926471
methyl (Z)-3-hydroxy-2-[(2R)-2-[(Z)-non-2-enyl]-3,4-dihydro-2H-pyrrol-5-yl]but-2-enoate (PubChem CID 135926471) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is methyl (Z)-3-hydroxy-2-[(2R)-2-[(Z)-non-2-enyl]-3,4-dihydro-2H-pyrrol-5-yl]but-2-enoate.
| Compound Name | methyl (Z)-3-hydroxy-2-[(2R)-2-[(Z)-non-2-enyl]-3,4-dihydro-2H-pyrrol-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 135926471 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | methyl (Z)-3-hydroxy-2-[(2R)-2-[(Z)-non-2-enyl]-3,4-dihydro-2H-pyrrol-5-yl]but-2-enoate |
| SMILES | CCCCCC/C=C\C[C@H]1CCC(/C(C(=O)OC)=C(\C)O)=N1 |
| InChI | InChI=1S/C18H29NO3/c1-4-5-6-7-8-9-10-11-15-12-13-16(19-15)17(14(2)20)18(21)22-3/h9-10,15,20H,4-8,11-13H2,1-3H3/b10-9-,17-14-/t15-/m0/s1 |
| InChIKey | BYNPGOOWPBGOIW-JOCLWEFTSA-N |
| XLogP | 4.51 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|