C11H17NO3 — CID 135471810
methyl (E)-3-hydroxy-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-2-enoate (PubChem CID 135471810) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl (E)-3-hydroxy-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-2-enoate.
| Compound Name | methyl (E)-3-hydroxy-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-2-enoate |
|---|---|
| PubChem CID | 135471810 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl (E)-3-hydroxy-2-(2,3,4,5-tetrahydropyridin-6-yl)pent-2-enoate |
| SMILES | CC/C(O)=C(\C(=O)OC)C1=NCCCC1 |
| InChI | InChI=1S/C11H17NO3/c1-3-9(13)10(11(14)15-2)8-6-4-5-7-12-8/h13H,3-7H2,1-2H3/b10-9+ |
| InChIKey | BXVVQRWNMRVMOP-MDZDMXLPSA-N |
| XLogP | 2.01 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|