About methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate
methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate (PubChem CID 5248192) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate |
| PubChem CID | 5248192 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate |
| SMILES | COC(=O)C1=C(/N=C2/C=CC=CC2)CCCCCC1 |
| InChI | InChI=1S/C16H21NO2/c1-19-16(18)14-11-7-2-3-8-12-15(14)17-13-9-5-4-6-10-13/h4-6,9H,2-3,7-8,10-12H2,1H3/b15-14?,17-13- |
| InChIKey | MVJYWVZCVSJMCB-CABNNLKDSA-N |
| XLogP | 3.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate?
The IUPAC name of methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate (CID 5248192) is methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate.
What is the SMILES notation for methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate?
The canonical SMILES for methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate is COC(=O)C1=C(/N=C2/C=CC=CC2)CCCCCC1.
What is the InChIKey of methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate?
The InChIKey is MVJYWVZCVSJMCB-CABNNLKDSA-N. The full InChI is InChI=1S/C16H21NO2/c1-19-16(18)14-11-7-2-3-8-12-15(14)17-13-9-5-4-6-10-13/h4-6,9H,2-3,7-8,10-12H2,1H3/b15-14?,17-13-.
What are the key properties of methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate?
methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate has a molecular weight of 259.35 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(cyclohexa-2,4-dien-1-ylideneamino)cyclooctene-1-carboxylate is sourced from PubChem (CID 5248192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).