C22H26F2N6O3S — CID 123519603
(2S)-2-[[3-fluoro-6-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyano-2-pyridinyl]amino]-N-(2-methoxyethyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 123519603) has the molecular formula C22H26F2N6O3S and a molecular weight of 492.55 g/mol. Its IUPAC name is (2S)-2-[[3-fluoro-6-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyano-2-pyridinyl]amino]-N-(2-methoxyethyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | (2S)-2-[[3-fluoro-6-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyano-2-pyridinyl]amino]-N-(2-methoxyethyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 123519603 |
| Molecular Formula | C22H26F2N6O3S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (2S)-2-[[3-fluoro-6-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-isocyano-2-pyridinyl]amino]-N-(2-methoxyethyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | [C-]#[N+]c1cc(F)c(N[C@H](CS(=O)(=O)NCCOC)C(C)(C)C)nc1-c1c[nH]c2ncc(F)cc12 |
| InChI | InChI=1S/C22H26F2N6O3S/c1-22(2,3)18(12-34(31,32)28-6-7-33-5)29-21-16(24)9-17(25-4)19(30-21)15-11-27-20-14(15)8-13(23)10-26-20/h8-11,18,28H,6-7,12H2,1-3,5H3,(H,26,27)(H,29,30)/t18-/m1/s1 |
| InChIKey | DXLRPMHNLDKHJV-GOSISDBHSA-N |
| XLogP | 3.85 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|