C25H27N2O+ — CID 123520264
15,15-diethyl-14,18,20-trimethyl-3-oxa-19-aza-16-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16(21),17,19-nonaene (PubChem CID 123520264) has the molecular formula C25H27N2O+ and a molecular weight of 371.50 g/mol. Its IUPAC name is 15,15-diethyl-14,18,20-trimethyl-3-oxa-19-aza-16-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16(21),17,19-nonaene.
| Compound Name | 15,15-diethyl-14,18,20-trimethyl-3-oxa-19-aza-16-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16(21),17,19-nonaene |
|---|---|
| PubChem CID | 123520264 |
| Molecular Formula | C25H27N2O+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 15,15-diethyl-14,18,20-trimethyl-3-oxa-19-aza-16-azoniapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,16(21),17,19-nonaene |
| SMILES | CCC1(CC)C(C)c2ccc3c(oc4ccccc43)c2-c2c(C)nc(C)c[n+]21 |
| InChI | InChI=1S/C25H27N2O/c1-6-25(7-2)16(4)18-12-13-20-19-10-8-9-11-21(19)28-24(20)22(18)23-17(5)26-15(3)14-27(23)25/h8-14,16H,6-7H2,1-5H3/q+1 |
| InChIKey | OSIZMXOCZIEUNT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|