C12H20N2O — CID 123521469
1-(3-methoxycyclohexa-1,5-dien-1-yl)-4-methylpiperazine (PubChem CID 123521469) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(3-methoxycyclohexa-1,5-dien-1-yl)-4-methylpiperazine.
| Compound Name | 1-(3-methoxycyclohexa-1,5-dien-1-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 123521469 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(3-methoxycyclohexa-1,5-dien-1-yl)-4-methylpiperazine |
| SMILES | COC1C=C(N2CCN(C)CC2)C=CC1 |
| InChI | InChI=1S/C12H20N2O/c1-13-6-8-14(9-7-13)11-4-3-5-12(10-11)15-2/h3-4,10,12H,5-9H2,1-2H3 |
| InChIKey | CECKYDABFIRALR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |