C27H45NO8 — CID 123522042
(2,5-dihydroxypyrrol-1-yl) 3-methyl-3-[3-methyl-3-(4-non-1-en-5-yloxy-4-oxobutoxy)butoxy]butanoate (PubChem CID 123522042) has the molecular formula C27H45NO8 and a molecular weight of 511.66 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-methyl-3-[3-methyl-3-(4-non-1-en-5-yloxy-4-oxobutoxy)butoxy]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-methyl-3-[3-methyl-3-(4-non-1-en-5-yloxy-4-oxobutoxy)butoxy]butanoate |
|---|---|
| PubChem CID | 123522042 |
| Molecular Formula | C27H45NO8 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-methyl-3-[3-methyl-3-(4-non-1-en-5-yloxy-4-oxobutoxy)butoxy]butanoate |
| SMILES | C=CCCC(CCCC)OC(=O)CCCOC(C)(C)CCOC(C)(C)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C27H45NO8/c1-7-9-12-21(13-10-8-2)35-24(31)14-11-18-33-26(3,4)17-19-34-27(5,6)20-25(32)36-28-22(29)15-16-23(28)30/h7,15-16,21,29-30H,1,8-14,17-20H2,2-6H3 |
| InChIKey | OBUKTUCSBJMNSX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|