C37H40N4O10 — CID 123522185
[2-[[5-amino-2-[[5-amino-2-[[5-amino-2-[(5-amino-2-methoxyphenyl)methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]-5-methylphenyl]methanol (PubChem CID 123522185) has the molecular formula C37H40N4O10 and a molecular weight of 700.75 g/mol. Its IUPAC name is [2-[[5-amino-2-[[5-amino-2-[[5-amino-2-[(5-amino-2-methoxyphenyl)methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]-5-methylphenyl]methanol.
| Compound Name | [2-[[5-amino-2-[[5-amino-2-[[5-amino-2-[(5-amino-2-methoxyphenyl)methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]-5-methylphenyl]methanol |
|---|---|
| PubChem CID | 123522185 |
| Molecular Formula | C37H40N4O10 |
| Molecular Weight | 700.75 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | [2-[[5-amino-2-[[5-amino-2-[[5-amino-2-[(5-amino-2-methoxyphenyl)methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]phenyl]methylperoxy]-5-methylphenyl]methanol |
| SMILES | COc1ccc(N)cc1COOc1ccc(N)cc1COOc1ccc(N)cc1COOc1ccc(N)cc1COOc1ccc(C)cc1CO |
| InChI | InChI=1S/C37H40N4O10/c1-23-3-8-34(24(13-23)18-42)48-45-20-26-15-30(39)6-11-36(26)50-47-22-28-17-32(41)7-12-37(28)51-46-21-27-16-31(40)5-10-35(27)49-44-19-25-14-29(38)4-9-33(25)43-2/h3-17,42H,18-22,38-41H2,1-2H3 |
| InChIKey | YXTQHQFKVCCIQY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 207.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|