About 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide
1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide (PubChem CID 123522975) has the molecular formula C22H30Cl2N4O
and a molecular weight of 437.42 g/mol. Its IUPAC name is 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide |
| PubChem CID | 123522975 |
| Molecular Formula | C22H30Cl2N4O |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide |
| SMILES | CCC(C)n1c(C2(N3CCC(C(N)=O)CC3)CCCC2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C22H30Cl2N4O/c1-3-14(2)28-19-13-17(24)16(23)12-18(19)26-21(28)22(8-4-5-9-22)27-10-6-15(7-11-27)20(25)29/h12-15H,3-11H2,1-2H3,(H2,25,29) |
| InChIKey | IPOJZVNGCHPQIX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide?
The IUPAC name of 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide (CID 123522975) is 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide is CCC(C)n1c(C2(N3CCC(C(N)=O)CC3)CCCC2)nc2cc(Cl)c(Cl)cc21.
What is the InChIKey of 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide?
The InChIKey is IPOJZVNGCHPQIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30Cl2N4O/c1-3-14(2)28-19-13-17(24)16(23)12-18(19)26-21(28)22(8-4-5-9-22)27-10-6-15(7-11-27)20(25)29/h12-15H,3-11H2,1-2H3,(H2,25,29).
What are the key properties of 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide?
1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide has a molecular weight of 437.42 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1-butan-2-yl-5,6-dichlorobenzimidazol-2-yl)cyclopentyl]piperidine-4-carboxamide is sourced from PubChem (CID 123522975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).